C25H22ClF2NO3 — CID 101040554
2-chloro-1,1-bis(4-fluorophenyl)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethanol (PubChem CID 101040554) has the molecular formula C25H22ClF2NO3 and a molecular weight of 457.90 g/mol. Its IUPAC name is 2-chloro-1,1-bis(4-fluorophenyl)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethanol.
| Compound Name | 2-chloro-1,1-bis(4-fluorophenyl)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethanol |
|---|---|
| PubChem CID | 101040554 |
| Molecular Formula | C25H22ClF2NO3 |
| Molecular Weight | 457.90 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-chloro-1,1-bis(4-fluorophenyl)-2-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]ethanol |
| SMILES | COC[C@@H]1N=C(C(Cl)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H22ClF2NO3/c1-31-15-21-22(16-5-3-2-4-6-16)32-24(29-21)23(26)25(30,17-7-11-19(27)12-8-17)18-9-13-20(28)14-10-18/h2-14,21-23,30H,15H2,1H3/t21-,22-,23?/m0/s1 |
| InChIKey | WLKYTMGBWJBADC-OJSMNCEXSA-N |
| XLogP | 4.99 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.90 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|