C20H22ClNO2 — CID 101117321
(2S)-2-chloro-1,1-diphenyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]ethanol (PubChem CID 101117321) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is (2S)-2-chloro-1,1-diphenyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]ethanol.
| Compound Name | (2S)-2-chloro-1,1-diphenyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]ethanol |
|---|---|
| PubChem CID | 101117321 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (2S)-2-chloro-1,1-diphenyl-2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]ethanol |
| SMILES | CC(C)[C@H]1COC([C@@H](Cl)C(O)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H22ClNO2/c1-14(2)17-13-24-19(22-17)18(21)20(23,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17-18,23H,13H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | AGVNADQXRHMMNZ-QZTJIDSGSA-N |
| XLogP | 3.98 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|