C19H20ClNO2 — CID 10914485
2-chloro-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylethanol (PubChem CID 10914485) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 2-chloro-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylethanol.
| Compound Name | 2-chloro-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylethanol |
|---|---|
| PubChem CID | 10914485 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-chloro-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,1-diphenylethanol |
| SMILES | CC1(C)COC(C(Cl)C(O)(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C19H20ClNO2/c1-18(2)13-23-17(21-18)16(20)19(22,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,22H,13H2,1-2H3 |
| InChIKey | COCSFGBCCZVBBY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|