C22H35O11S- — CID 101117850
2-[3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]benzenesulfonate (PubChem CID 101117850) has the molecular formula C22H35O11S- and a molecular weight of 507.58 g/mol. Its IUPAC name is 2-[3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]benzenesulfonate.
| Compound Name | 2-[3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]benzenesulfonate |
|---|---|
| PubChem CID | 101117850 |
| Molecular Formula | C22H35O11S- |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-[3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]benzenesulfonate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCC(=O)c1ccccc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C22H36O11S/c1-27-8-9-29-12-13-31-16-17-33-19-18-32-15-14-30-11-10-28-7-6-21(23)20-4-2-3-5-22(20)34(24,25)26/h2-5H,6-19H2,1H3,(H,24,25,26)/p-1 |
| InChIKey | HXEWXNSCNBAZNF-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|