C9H13NO3S2 — CID 101118668
[(1S,2R)-2-amino-1-sulfosulfanylpropyl]benzene (PubChem CID 101118668) has the molecular formula C9H13NO3S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is [(1S,2R)-2-amino-1-sulfosulfanylpropyl]benzene.
| Compound Name | [(1S,2R)-2-amino-1-sulfosulfanylpropyl]benzene |
|---|---|
| PubChem CID | 101118668 |
| Molecular Formula | C9H13NO3S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | [(1S,2R)-2-amino-1-sulfosulfanylpropyl]benzene |
| SMILES | C[C@@H](N)[C@@H](SS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO3S2/c1-7(10)9(14-15(11,12)13)8-5-3-2-4-6-8/h2-7,9H,10H2,1H3,(H,11,12,13)/t7-,9-/m1/s1 |
| InChIKey | IAOHVAANEKOGRU-VXNVDRBHSA-N |
| XLogP | 1.61 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|