C7H7ClN+ — CID 101120031
2-(chloromethyl)cyclohexa-2,4-dien-1-imine (PubChem CID 101120031) has the molecular formula C7H7ClN+ and a molecular weight of 140.59 g/mol. Its IUPAC name is 2-(chloromethyl)cyclohexa-2,4-dien-1-imine.
| Compound Name | 2-(chloromethyl)cyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 101120031 |
| Molecular Formula | C7H7ClN+ |
| Molecular Weight | 140.59 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 2-(chloromethyl)cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\[CH+]C=CC=C1CCl |
| InChI | InChI=1S/C7H7ClN/c8-5-6-3-1-2-4-7(6)9/h1-4,9H,5H2/q+1/b9-7+ |
| InChIKey | WXVIQRIPJZXKCS-VQHVLOKHSA-N |
| XLogP | 1.95 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.59 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|