C31H38O10 — CID 101120265
[(1Z,19Z,21Z)-23-(1-hydroxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate (PubChem CID 101120265) has the molecular formula C31H38O10 and a molecular weight of 570.64 g/mol. Its IUPAC name is [(1Z,19Z,21Z)-23-(1-hydroxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate.
| Compound Name | [(1Z,19Z,21Z)-23-(1-hydroxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate |
|---|---|
| PubChem CID | 101120265 |
| Molecular Formula | C31H38O10 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | [(1Z,19Z,21Z)-23-(1-hydroxyethyl)-9,15-dimethyl-3,18-dioxospiro[4,12,17,24-tetraoxapentacyclo[21.3.1.113,16.06,11.06,15]octacosa-1,9,19,21-tetraene-14,2'-oxirane]-27-yl] acetate |
| SMILES | CC(=O)OC1/C2=C/C(=O)OCC34CCC(C)=CC3OC3CC(OC(=O)/C=C\C=C/C1(C(C)O)OCC2)C4(C)C31CO1 |
| InChI | InChI=1S/C31H38O10/c1-18-8-11-29-16-36-26(35)14-21-9-12-37-30(19(2)32,27(21)39-20(3)33)10-6-5-7-25(34)41-22-15-24(40-23(29)13-18)31(17-38-31)28(22,29)4/h5-7,10,13-14,19,22-24,27,32H,8-9,11-12,15-17H2,1-4H3/b7-5-,10-6-,21-14+ |
| InChIKey | YFKYOBAFGWNPSA-ARCDBHOCSA-N |
| XLogP | 2.64 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|