C12H7N5O2 — CID 101123312
methyl (2Z)-2-cyano-2-[(2,5-dicyanophenyl)hydrazinylidene]acetate (PubChem CID 101123312) has the molecular formula C12H7N5O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is methyl (2Z)-2-cyano-2-[(2,5-dicyanophenyl)hydrazinylidene]acetate.
| Compound Name | methyl (2Z)-2-cyano-2-[(2,5-dicyanophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 101123312 |
| Molecular Formula | C12H7N5O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | methyl (2Z)-2-cyano-2-[(2,5-dicyanophenyl)hydrazinylidene]acetate |
| SMILES | COC(=O)/C(C#N)=N\Nc1cc(C#N)ccc1C#N |
| InChI | InChI=1S/C12H7N5O2/c1-19-12(18)11(7-15)17-16-10-4-8(5-13)2-3-9(10)6-14/h2-4,16H,1H3/b17-11- |
| InChIKey | IVFUTCIPOFSGEM-BOPFTXTBSA-N |
| XLogP | 0.89 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|