C8H15N3O2 — CID 101127150
(2E)-1,5,5-trimethyl-2-(nitromethylidene)-1,3-diazinane (PubChem CID 101127150) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is (2E)-1,5,5-trimethyl-2-(nitromethylidene)-1,3-diazinane.
| Compound Name | (2E)-1,5,5-trimethyl-2-(nitromethylidene)-1,3-diazinane |
|---|---|
| PubChem CID | 101127150 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2E)-1,5,5-trimethyl-2-(nitromethylidene)-1,3-diazinane |
| SMILES | CN1CC(C)(C)CN/C1=C\[N+](=O)[O-] |
| InChI | InChI=1S/C8H15N3O2/c1-8(2)5-9-7(4-11(12)13)10(3)6-8/h4,9H,5-6H2,1-3H3/b7-4+ |
| InChIKey | ZKDMMJQYYOPXMV-QPJJXVBHSA-N |
| XLogP | 0.62 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|