C8H15N3O2 — CID 21486039
(2Z)-2-(nitromethylidene)-1-propyl-1,3-diazinane (PubChem CID 21486039) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is (2Z)-2-(nitromethylidene)-1-propyl-1,3-diazinane.
| Compound Name | (2Z)-2-(nitromethylidene)-1-propyl-1,3-diazinane |
|---|---|
| PubChem CID | 21486039 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2Z)-2-(nitromethylidene)-1-propyl-1,3-diazinane |
| SMILES | CCCN1CCCN/C1=C/[N+](=O)[O-] |
| InChI | InChI=1S/C8H15N3O2/c1-2-5-10-6-3-4-9-8(10)7-11(12)13/h7,9H,2-6H2,1H3/b8-7- |
| InChIKey | QFBLKTCLXZSWCA-FPLPWBNLSA-N |
| XLogP | 0.77 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|