C27H50NNaO13 — CID 101127530
sodium 6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoate (PubChem CID 101127530) has the molecular formula C27H50NNaO13 and a molecular weight of 619.68 g/mol. Its IUPAC name is sodium 6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoate.
| Compound Name | sodium 6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoate |
|---|---|
| PubChem CID | 101127530 |
| Molecular Formula | C27H50NNaO13 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | sodium 6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoate |
| SMILES | CCCCCCCCC(=O)N(CCCCCC(=O)[O-])C[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO.[Na+] |
| InChI | InChI=1S/C27H51NO13.Na/c1-2-3-4-5-6-8-11-20(33)28(13-10-7-9-12-21(34)35)14-17(31)22(36)26(18(32)15-29)41-27-25(39)24(38)23(37)19(16-30)40-27;/h17-19,22-27,29-32,36-39H,2-16H2,1H3,(H,34,35);/q;+1/p-1/t17-,18+,19+,22+,23-,24-,25+,26+,27-;/m0./s1 |
| InChIKey | QWRWYVCJPCGUGZ-LDYLYEHOSA-M |
| XLogP | -5.86 |
| TPSA | 240.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | -5.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|