C27H50N2O13 — CID 102274484
2-[[octyl-[2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 102274484) has the molecular formula C27H50N2O13 and a molecular weight of 610.70 g/mol. Its IUPAC name is 2-[[octyl-[2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[octyl-[2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102274484 |
| Molecular Formula | C27H50N2O13 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | 2-[[octyl-[2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)N(CCCCCCCC)CC(O)C(O)C(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(O)CO |
| InChI | InChI=1S/C27H50N2O13/c1-4-5-6-7-8-9-11-29(27(39)28-10-12-40-25(38)16(2)3)13-17(32)20(34)24(18(33)14-30)42-26-23(37)22(36)21(35)19(15-31)41-26/h17-24,26,30-37H,2,4-15H2,1,3H3,(H,28,39)/t17?,18?,19-,20?,21-,22+,23-,24?,26-/m1/s1 |
| InChIKey | SGRNFMLVPDLCHR-HFEGHXEBSA-N |
| XLogP | -2.26 |
| TPSA | 238.94 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|