C27H51NO13 — CID 101127531
6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoic acid (PubChem CID 101127531) has the molecular formula C27H51NO13 and a molecular weight of 597.70 g/mol. Its IUPAC name is 6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoic acid.
| Compound Name | 6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101127531 |
| Molecular Formula | C27H51NO13 |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.34 |
| IUPAC Name | 6-[nonanoyl-[(2S,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]amino]hexanoic acid |
| SMILES | CCCCCCCCC(=O)N(CCCCCC(=O)O)C[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO |
| InChI | InChI=1S/C27H51NO13/c1-2-3-4-5-6-8-11-20(33)28(13-10-7-9-12-21(34)35)14-17(31)22(36)26(18(32)15-29)41-27-25(39)24(38)23(37)19(16-30)40-27/h17-19,22-27,29-32,36-39H,2-16H2,1H3,(H,34,35)/t17-,18+,19+,22+,23-,24-,25+,26+,27-/m0/s1 |
| InChIKey | LHTYKTIOBNCIDB-VEXRCSFYSA-N |
| XLogP | -1.53 |
| TPSA | 237.91 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|