C18H31NO13 — CID 102037461
2-[[(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 102037461) has the molecular formula C18H31NO13 and a molecular weight of 469.44 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102037461 |
| Molecular Formula | C18H31NO13 |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 2-[[(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)[C@H](O)[C@@H](O)[C@H](O[C@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O)[C@H](O)CO |
| InChI | InChI=1S/C18H31NO13/c1-7(2)17(29)30-4-3-19-16(28)13(26)12(25)15(8(22)5-20)32-18-14(27)11(24)10(23)9(6-21)31-18/h8-15,18,20-27H,1,3-6H2,2H3,(H,19,28)/t8-,9+,10-,11-,12-,13-,14+,15-,18-/m1/s1 |
| InChIKey | PJJMXOJIRGWZEO-YXRZIVNPSA-N |
| XLogP | -5.52 |
| TPSA | 235.70 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|