C20H40N2O11 — CID 142036976
(2R,3R,4S,5R)-N-(8-aminooctyl)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide (PubChem CID 142036976) has the molecular formula C20H40N2O11 and a molecular weight of 484.54 g/mol. Its IUPAC name is (2R,3R,4S,5R)-N-(8-aminooctyl)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide.
| Compound Name | (2R,3R,4S,5R)-N-(8-aminooctyl)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
|---|---|
| PubChem CID | 142036976 |
| Molecular Formula | C20H40N2O11 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (2R,3R,4S,5R)-N-(8-aminooctyl)-2,3,5,6-tetrahydroxy-4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
| SMILES | NCCCCCCCCNC(=O)[C@H](O)[C@@H](O)[C@@H](O[C@@H]1OC(CO)[C@H](O)C(O)C1O)[C@H](O)CO |
| InChI | InChI=1S/C20H40N2O11/c21-7-5-3-1-2-4-6-8-22-19(31)16(29)15(28)18(11(25)9-23)33-20-17(30)14(27)13(26)12(10-24)32-20/h11-18,20,23-30H,1-10,21H2,(H,22,31)/t11-,12?,13+,14?,15-,16-,17?,18+,20+/m1/s1 |
| InChIKey | MWMYQCUHNBPIIV-UZGMOIAISA-N |
| XLogP | -4.34 |
| TPSA | 235.42 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|