C20H23NO5S — CID 101128455
methyl (4aS,8aR)-6,7-dimethyl-1-(2-methylphenyl)sulfonyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate (PubChem CID 101128455) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is methyl (4aS,8aR)-6,7-dimethyl-1-(2-methylphenyl)sulfonyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate.
| Compound Name | methyl (4aS,8aR)-6,7-dimethyl-1-(2-methylphenyl)sulfonyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate |
|---|---|
| PubChem CID | 101128455 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | methyl (4aS,8aR)-6,7-dimethyl-1-(2-methylphenyl)sulfonyl-2-oxo-8,8a-dihydro-5H-quinoline-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C=CC(=O)N(S(=O)(=O)c3ccccc3C)[C@@H]1CC(C)=C(C)C2 |
| InChI | InChI=1S/C20H23NO5S/c1-13-7-5-6-8-16(13)27(24,25)21-17-11-14(2)15(3)12-20(17,19(23)26-4)10-9-18(21)22/h5-10,17H,11-12H2,1-4H3/t17-,20-/m1/s1 |
| InChIKey | PKAYXACEYWKBTM-YLJYHZDGSA-N |
| XLogP | 2.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|