C12H16ClNO2 — CID 101130115
[(2R,3R,4E,6E)-7-cyano-3-ethylhepta-4,6-dien-2-yl] 2-chloroacetate (PubChem CID 101130115) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is [(2R,3R,4E,6E)-7-cyano-3-ethylhepta-4,6-dien-2-yl] 2-chloroacetate.
| Compound Name | [(2R,3R,4E,6E)-7-cyano-3-ethylhepta-4,6-dien-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 101130115 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | [(2R,3R,4E,6E)-7-cyano-3-ethylhepta-4,6-dien-2-yl] 2-chloroacetate |
| SMILES | CC[C@H](/C=C/C=C/C#N)[C@@H](C)OC(=O)CCl |
| InChI | InChI=1S/C12H16ClNO2/c1-3-11(7-5-4-6-8-14)10(2)16-12(15)9-13/h4-7,10-11H,3,9H2,1-2H3/b6-4+,7-5+/t10-,11-/m1/s1 |
| InChIKey | ZKONVQOILDWQRN-MOCDJNTMSA-N |
| XLogP | 2.82 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|