C22H32N2O3SSi — CID 101130658
N-[1-[dimethyl(phenyl)silyl]propyl]-N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 101130658) has the molecular formula C22H32N2O3SSi and a molecular weight of 432.66 g/mol. Its IUPAC name is N-[1-[dimethyl(phenyl)silyl]propyl]-N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[1-[dimethyl(phenyl)silyl]propyl]-N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 101130658 |
| Molecular Formula | C22H32N2O3SSi |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-[1-[dimethyl(phenyl)silyl]propyl]-N-methyl-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | CCC(N(C)C(=O)CN(C)S(=O)(=O)c1ccc(C)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H32N2O3SSi/c1-7-22(29(5,6)20-11-9-8-10-12-20)24(4)21(25)17-23(3)28(26,27)19-15-13-18(2)14-16-19/h8-16,22H,7,17H2,1-6H3 |
| InChIKey | UCCRPEVLBJCYCY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|