C12H20OSi — CID 101130734
trans-(1R,2R)-2-(2-trimethylsilylethynyl)cyclohexane-1-carbaldehyde (PubChem CID 101130734) has the molecular formula C12H20OSi and a molecular weight of 208.38 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-trimethylsilylethynyl)cyclohexane-1-carbaldehyde.
| Compound Name | trans-(1R,2R)-2-(2-trimethylsilylethynyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 101130734 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | trans-(1R,2R)-2-(2-trimethylsilylethynyl)cyclohexane-1-carbaldehyde |
| SMILES | C[Si](C)(C)C#C[C@@H]1CCCC[C@H]1C=O |
| InChI | InChI=1S/C12H20OSi/c1-14(2,3)9-8-11-6-4-5-7-12(11)10-13/h10-12H,4-7H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | SHGNPSOMUYLRKL-RYUDHWBXSA-N |
| XLogP | 2.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|