C14H24Si — CID 11264500
trimethyl-[2-[(1S,2R)-2-prop-2-enylcyclohexyl]ethynyl]silane (PubChem CID 11264500) has the molecular formula C14H24Si and a molecular weight of 220.43 g/mol. Its IUPAC name is trimethyl-[2-[(1S,2R)-2-prop-2-enylcyclohexyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(1S,2R)-2-prop-2-enylcyclohexyl]ethynyl]silane |
|---|---|
| PubChem CID | 11264500 |
| Molecular Formula | C14H24Si |
| Molecular Weight | 220.43 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | trimethyl-[2-[(1S,2R)-2-prop-2-enylcyclohexyl]ethynyl]silane |
| SMILES | C=CC[C@H]1CCCC[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H24Si/c1-5-8-13-9-6-7-10-14(13)11-12-15(2,3)4/h5,13-14H,1,6-10H2,2-4H3/t13-,14+/m0/s1 |
| InChIKey | ZJZMDBWNBFAVFF-UONOGXRCSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|