C27H49ClO4Si — CID 101131316
methyl (2E,4E,6S,7S,10Z)-13-chloro-7-methoxy-2,6,10-trimethyl-12-tri(propan-2-yl)silyloxytrideca-2,4,10-trienoate (PubChem CID 101131316) has the molecular formula C27H49ClO4Si and a molecular weight of 501.22 g/mol. Its IUPAC name is methyl (2E,4E,6S,7S,10Z)-13-chloro-7-methoxy-2,6,10-trimethyl-12-tri(propan-2-yl)silyloxytrideca-2,4,10-trienoate.
| Compound Name | methyl (2E,4E,6S,7S,10Z)-13-chloro-7-methoxy-2,6,10-trimethyl-12-tri(propan-2-yl)silyloxytrideca-2,4,10-trienoate |
|---|---|
| PubChem CID | 101131316 |
| Molecular Formula | C27H49ClO4Si |
| Molecular Weight | 501.22 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | methyl (2E,4E,6S,7S,10Z)-13-chloro-7-methoxy-2,6,10-trimethyl-12-tri(propan-2-yl)silyloxytrideca-2,4,10-trienoate |
| SMILES | COC(=O)/C(C)=C/C=C/[C@H](C)[C@H](CC/C(C)=C\C(CCl)O[Si](C(C)C)(C(C)C)C(C)C)OC |
| InChI | InChI=1S/C27H49ClO4Si/c1-19(2)33(20(3)4,21(5)6)32-25(18-28)17-22(7)15-16-26(30-10)23(8)13-12-14-24(9)27(29)31-11/h12-14,17,19-21,23,25-26H,15-16,18H2,1-11H3/b13-12+,22-17-,24-14+/t23-,25?,26-/m0/s1 |
| InChIKey | JQXMQLJHGUQGKX-FASLZJHWSA-N |
| XLogP | 7.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.22 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|