C26H49ClO4Si — CID 23242994
(3Z,7R,8R,9E,11Z)-1-chloro-7-(methoxymethoxy)-4,8-dimethyl-13-tri(propan-2-yl)silyloxytrideca-3,9,11-trien-2-ol (PubChem CID 23242994) has the molecular formula C26H49ClO4Si and a molecular weight of 489.21 g/mol. Its IUPAC name is (3Z,7R,8R,9E,11Z)-1-chloro-7-(methoxymethoxy)-4,8-dimethyl-13-tri(propan-2-yl)silyloxytrideca-3,9,11-trien-2-ol.
| Compound Name | (3Z,7R,8R,9E,11Z)-1-chloro-7-(methoxymethoxy)-4,8-dimethyl-13-tri(propan-2-yl)silyloxytrideca-3,9,11-trien-2-ol |
|---|---|
| PubChem CID | 23242994 |
| Molecular Formula | C26H49ClO4Si |
| Molecular Weight | 489.21 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | (3Z,7R,8R,9E,11Z)-1-chloro-7-(methoxymethoxy)-4,8-dimethyl-13-tri(propan-2-yl)silyloxytrideca-3,9,11-trien-2-ol |
| SMILES | COCO[C@H](CC/C(C)=C\C(O)CCl)[C@H](C)/C=C/C=C\CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H49ClO4Si/c1-20(2)32(21(3)4,22(5)6)31-16-12-10-11-13-24(8)26(30-19-29-9)15-14-23(7)17-25(28)18-27/h10-13,17,20-22,24-26,28H,14-16,18-19H2,1-9H3/b12-10-,13-11+,23-17-/t24-,25?,26-/m1/s1 |
| InChIKey | JJVXXRMFRIRQCL-WXUOHOGNSA-N |
| XLogP | 7.24 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.21 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|