C21H36O5Si — CID 102398075
1-O-methyl 4-O-[(2E,4E,6S)-6-tri(propan-2-yl)silyloxyhepta-2,4-dienyl] (Z)-but-2-enedioate (PubChem CID 102398075) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2E,4E,6S)-6-tri(propan-2-yl)silyloxyhepta-2,4-dienyl] (Z)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(2E,4E,6S)-6-tri(propan-2-yl)silyloxyhepta-2,4-dienyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 102398075 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-O-methyl 4-O-[(2E,4E,6S)-6-tri(propan-2-yl)silyloxyhepta-2,4-dienyl] (Z)-but-2-enedioate |
| SMILES | COC(=O)/C=C\C(=O)OC/C=C/C=C/[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H36O5Si/c1-16(2)27(17(3)4,18(5)6)26-19(7)12-10-9-11-15-25-21(23)14-13-20(22)24-8/h9-14,16-19H,15H2,1-8H3/b11-9+,12-10+,14-13-/t19-/m0/s1 |
| InChIKey | AJBHUPRAKXWQNA-SIUAMPKXSA-N |
| XLogP | 4.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|