C25H23Br2NO — CID 101132622
(1R,2S)-2-[[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]methyl-methylamino]-1-phenylpropan-1-ol (PubChem CID 101132622) has the molecular formula C25H23Br2NO and a molecular weight of 513.27 g/mol. Its IUPAC name is (1R,2S)-2-[[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]methyl-methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]methyl-methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 101132622 |
| Molecular Formula | C25H23Br2NO |
| Molecular Weight | 513.27 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | (1R,2S)-2-[[4-[2-(3,5-dibromophenyl)ethynyl]phenyl]methyl-methylamino]-1-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)Cc1ccc(C#Cc2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C25H23Br2NO/c1-18(25(29)22-6-4-3-5-7-22)28(2)17-20-11-8-19(9-12-20)10-13-21-14-23(26)16-24(27)15-21/h3-9,11-12,14-16,18,25,29H,17H2,1-2H3/t18-,25-/m0/s1 |
| InChIKey | KSAFJTZDAFYJLX-BVZFJXPGSA-N |
| XLogP | 6.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.27 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|