C17H20N3O7S- — CID 101132896
2-[4-amino-4-oxo-3-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]sulfanylacetate (PubChem CID 101132896) has the molecular formula C17H20N3O7S- and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[4-amino-4-oxo-3-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]sulfanylacetate.
| Compound Name | 2-[4-amino-4-oxo-3-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]sulfanylacetate |
|---|---|
| PubChem CID | 101132896 |
| Molecular Formula | C17H20N3O7S- |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-[4-amino-4-oxo-3-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]butanoyl]sulfanylacetate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)SCC(=O)[O-])C(N)=O |
| InChI | InChI=1S/C17H21N3O7S/c1-10(19-17(26)27-8-11-5-3-2-4-6-11)16(25)20-12(15(18)24)7-14(23)28-9-13(21)22/h2-6,10,12H,7-9H2,1H3,(H2,18,24)(H,19,26)(H,20,25)(H,21,22)/p-1/t10-,12?/m0/s1 |
| InChIKey | DAFYSSUIXYLXKH-NUHJPDEHSA-M |
| XLogP | -1.33 |
| TPSA | 167.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|