C17H19F9O4 — CID 101133860
methyl 2-[9-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate (PubChem CID 101133860) has the molecular formula C17H19F9O4 and a molecular weight of 458.32 g/mol. Its IUPAC name is methyl 2-[9-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate.
| Compound Name | methyl 2-[9-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
|---|---|
| PubChem CID | 101133860 |
| Molecular Formula | C17H19F9O4 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | methyl 2-[9-[(E)-4,4,5,5,6,6,7,7,7-nonafluorohept-2-enyl]-1,4-dioxaspiro[4.4]nonan-8-yl]acetate |
| SMILES | COC(=O)CC1CCC2(OCCO2)C1C/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H19F9O4/c1-28-12(27)9-10-4-6-13(29-7-8-30-13)11(10)3-2-5-14(18,19)15(20,21)16(22,23)17(24,25)26/h2,5,10-11H,3-4,6-9H2,1H3/b5-2+ |
| InChIKey | UNNJXPHYFSDNFK-GORDUTHDSA-N |
| XLogP | 4.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|