C24H40F2O5 — CID 71056946
methyl (Z)-8-[(2R,3R)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3-hydroxycyclopentyl]oct-6-enoate (PubChem CID 71056946) has the molecular formula C24H40F2O5 and a molecular weight of 446.58 g/mol. Its IUPAC name is methyl (Z)-8-[(2R,3R)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3-hydroxycyclopentyl]oct-6-enoate.
| Compound Name | methyl (Z)-8-[(2R,3R)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3-hydroxycyclopentyl]oct-6-enoate |
|---|---|
| PubChem CID | 71056946 |
| Molecular Formula | C24H40F2O5 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | methyl (Z)-8-[(2R,3R)-2-[2-[2-(1,1-difluoropentyl)-1,3-dioxolan-2-yl]ethyl]-3-hydroxycyclopentyl]oct-6-enoate |
| SMILES | CCCCC(F)(F)C1(CC[C@@H]2C(C/C=C\CCCCC(=O)OC)CC[C@H]2O)OCCO1 |
| InChI | InChI=1S/C24H40F2O5/c1-3-4-15-23(25,26)24(30-17-18-31-24)16-14-20-19(12-13-21(20)27)10-8-6-5-7-9-11-22(28)29-2/h6,8,19-21,27H,3-5,7,9-18H2,1-2H3/b8-6-/t19?,20-,21-/m1/s1 |
| InChIKey | OELJTTLNQNQNTP-WONQRVFASA-N |
| XLogP | 5.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|