(E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid

C10H9F9O2 — CID 101133862

IUPAC(E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid
SMILESO=C(O)CCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C10H9F9O2/c11-7(12,5-3-1-2-4-6(20)21)8(13,14)9(15,16)10(17,18)19/h3,5H,1-2,4H2,(H,20,21)/b5-3+
InChIKeyOZNWHNCMBLMZJI-HWKANZROSA-N
MW332.16 g/mol
LogP4.27
Rot. Bonds7

About (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid

(E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid (PubChem CID 101133862) has the molecular formula C10H9F9O2 and a molecular weight of 332.16 g/mol. Its IUPAC name is (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid.

Molecular Properties

Compound Name(E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid
PubChem CID101133862
Molecular FormulaC10H9F9O2
Molecular Weight332.16 g/mol
Exact Mass332.05
IUPAC Name(E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid
SMILESO=C(O)CCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
InChIInChI=1S/C10H9F9O2/c11-7(12,5-3-1-2-4-6(20)21)8(13,14)9(15,16)10(17,18)19/h3,5H,1-2,4H2,(H,20,21)/b5-3+
InChIKeyOZNWHNCMBLMZJI-HWKANZROSA-N
XLogP4.27
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.16
LogP ≤ 54.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(5Z)-5-octenoic acid
CID 5282718
trans-delta-Octenoic acid
CID 5282719
5E,9-decadienoic acid
CID 5312363
20-Fluoroarachidonic acid
CID 6439507
5-Fluoroarachidonic acid
CID 6443888
20,20,20-Trifluoroarachidonic acid
CID 6443934
Oct-5-enoic acid
CID 53436338
20-Trifluoroarachidonic acid
CID 88207451
(5Z,8Z,11Z,14Z)-10,10-difluoroicosa-5,8,11,14-tetraenoic acid
CID 88374750
2,2-Difluoro-5-hexenoic acid
CID 11535590
(5Z,8Z,11Z,14Z)-20-(18F)fluoroicosa-5,8,11,14-tetraenoic acid
CID 5462113
10,10-Difluoroarachidonic acid
CID 6444130

Frequently Asked Questions

What is the IUPAC name of (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid?
The IUPAC name of (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid (CID 101133862) is (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid.
What is the SMILES notation for (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid?
The canonical SMILES for (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid is O=C(O)CCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid?
The InChIKey is OZNWHNCMBLMZJI-HWKANZROSA-N. The full InChI is InChI=1S/C10H9F9O2/c11-7(12,5-3-1-2-4-6(20)21)8(13,14)9(15,16)10(17,18)19/h3,5H,1-2,4H2,(H,20,21)/b5-3+.
What are the key properties of (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid?
(E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid has a molecular weight of 332.16 g/mol, XLogP of 4.27, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7,7,8,8,9,9,10,10,10-nonafluorodec-5-enoic acid is sourced from PubChem (CID 101133862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).