C11H14N6O5S2 — CID 101134254
1-(diaminomethylidene)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea (PubChem CID 101134254) has the molecular formula C11H14N6O5S2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea.
| Compound Name | 1-(diaminomethylidene)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea |
|---|---|
| PubChem CID | 101134254 |
| Molecular Formula | C11H14N6O5S2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 1-(diaminomethylidene)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea |
| SMILES | CCS(=O)(=O)c1nc2ccccn2c1S(=O)(=O)NC(=O)N=C(N)N |
| InChI | InChI=1S/C11H14N6O5S2/c1-2-23(19,20)8-9(17-6-4-3-5-7(17)14-8)24(21,22)16-11(18)15-10(12)13/h3-6H,2H2,1H3,(H5,12,13,15,16,18) |
| InChIKey | QVPXXOJRJDDMIV-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 179.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|