C10H12N4O5S2 — CID 91103679
(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea (PubChem CID 91103679) has the molecular formula C10H12N4O5S2 and a molecular weight of 332.36 g/mol. Its IUPAC name is (2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea.
| Compound Name | (2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea |
|---|---|
| PubChem CID | 91103679 |
| Molecular Formula | C10H12N4O5S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea |
| SMILES | CCS(=O)(=O)c1nc2ccccn2c1S(=O)(=O)NC(N)=O |
| InChI | InChI=1S/C10H12N4O5S2/c1-2-20(16,17)8-9(21(18,19)13-10(11)15)14-6-4-3-5-7(14)12-8/h3-6H,2H2,1H3,(H3,11,13,15) |
| InChIKey | XOHMJAPFRWCQMP-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |