C10H15O2P — CID 101135758
2-but-3-enoxy-3-ethenyl-5,6-dihydrooxaphosphinine (PubChem CID 101135758) has the molecular formula C10H15O2P and a molecular weight of 198.20 g/mol. Its IUPAC name is 2-but-3-enoxy-3-ethenyl-5,6-dihydrooxaphosphinine.
| Compound Name | 2-but-3-enoxy-3-ethenyl-5,6-dihydrooxaphosphinine |
|---|---|
| PubChem CID | 101135758 |
| Molecular Formula | C10H15O2P |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-but-3-enoxy-3-ethenyl-5,6-dihydrooxaphosphinine |
| SMILES | C=CCCOP1OCCC=C1C=C |
| InChI | InChI=1S/C10H15O2P/c1-3-5-8-11-13-10(4-2)7-6-9-12-13/h3-4,7H,1-2,5-6,8-9H2 |
| InChIKey | XXINHTKXQXERPS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|