C9H15O2P — CID 14092722
cyclopenta-2,4-dien-1-yl(diethoxy)phosphane (PubChem CID 14092722) has the molecular formula C9H15O2P and a molecular weight of 186.19 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl(diethoxy)phosphane.
| Compound Name | cyclopenta-2,4-dien-1-yl(diethoxy)phosphane |
|---|---|
| PubChem CID | 14092722 |
| Molecular Formula | C9H15O2P |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl(diethoxy)phosphane |
| SMILES | CCOP(OCC)C1C=CC=C1 |
| InChI | InChI=1S/C9H15O2P/c1-3-10-12(11-4-2)9-7-5-6-8-9/h5-9H,3-4H2,1-2H3 |
| InChIKey | IAEDSOSXCLNBQF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|