C13H23O2P — CID 143275100
[(2Z,4E,6E)-8,8-dimethylnona-2,4,6-trien-5-yl]-ethoxyphosphinous acid (PubChem CID 143275100) has the molecular formula C13H23O2P and a molecular weight of 242.30 g/mol. Its IUPAC name is [(2Z,4E,6E)-8,8-dimethylnona-2,4,6-trien-5-yl]-ethoxyphosphinous acid.
| Compound Name | [(2Z,4E,6E)-8,8-dimethylnona-2,4,6-trien-5-yl]-ethoxyphosphinous acid |
|---|---|
| PubChem CID | 143275100 |
| Molecular Formula | C13H23O2P |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | [(2Z,4E,6E)-8,8-dimethylnona-2,4,6-trien-5-yl]-ethoxyphosphinous acid |
| SMILES | C/C=C\C=C(/C=C/C(C)(C)C)P(O)OCC |
| InChI | InChI=1S/C13H23O2P/c1-6-8-9-12(16(14)15-7-2)10-11-13(3,4)5/h6,8-11,14H,7H2,1-5H3/b8-6-,11-10+,12-9+ |
| InChIKey | BFHJXNOGKJHGNZ-SUUBFGSUSA-N |
| XLogP | 4.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|