C11H23O3P — CID 11276370
(E)-2-diethoxyphosphoryl-4,4-dimethylpent-2-ene (PubChem CID 11276370) has the molecular formula C11H23O3P and a molecular weight of 234.28 g/mol. Its IUPAC name is (E)-2-diethoxyphosphoryl-4,4-dimethylpent-2-ene.
| Compound Name | (E)-2-diethoxyphosphoryl-4,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 11276370 |
| Molecular Formula | C11H23O3P |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (E)-2-diethoxyphosphoryl-4,4-dimethylpent-2-ene |
| SMILES | CCOP(=O)(OCC)/C(C)=C/C(C)(C)C |
| InChI | InChI=1S/C11H23O3P/c1-7-13-15(12,14-8-2)10(3)9-11(4,5)6/h9H,7-8H2,1-6H3/b10-9+ |
| InChIKey | OVPNABIZGNAHNC-MDZDMXLPSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|