C13H25O2P — CID 171063812
ethane;[(3Z)-3-ethenylhexa-3,5-dienoxy]-ethoxy-methylphosphane (PubChem CID 171063812) has the molecular formula C13H25O2P and a molecular weight of 244.31 g/mol. Its IUPAC name is ethane;[(3Z)-3-ethenylhexa-3,5-dienoxy]-ethoxy-methylphosphane.
| Compound Name | ethane;[(3Z)-3-ethenylhexa-3,5-dienoxy]-ethoxy-methylphosphane |
|---|---|
| PubChem CID | 171063812 |
| Molecular Formula | C13H25O2P |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | ethane;[(3Z)-3-ethenylhexa-3,5-dienoxy]-ethoxy-methylphosphane |
| SMILES | C=C/C=C(\C=C)CCOP(C)OCC.CC |
| InChI | InChI=1S/C11H19O2P.C2H6/c1-5-8-11(6-2)9-10-13-14(4)12-7-3;1-2/h5-6,8H,1-2,7,9-10H2,3-4H3;1-2H3/b11-8+; |
| InChIKey | GDKNGAZXMRUVFQ-YGCVIUNWSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|