C12H21O3P — CID 141154925
5-diethoxyphosphoryl-2,5-dimethylcyclohexa-1,3-diene (PubChem CID 141154925) has the molecular formula C12H21O3P and a molecular weight of 244.27 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-2,5-dimethylcyclohexa-1,3-diene.
| Compound Name | 5-diethoxyphosphoryl-2,5-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141154925 |
| Molecular Formula | C12H21O3P |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 5-diethoxyphosphoryl-2,5-dimethylcyclohexa-1,3-diene |
| SMILES | CCOP(=O)(OCC)C1(C)C=CC(C)=CC1 |
| InChI | InChI=1S/C12H21O3P/c1-5-14-16(13,15-6-2)12(4)9-7-11(3)8-10-12/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | ADQKGKKOTPXGQF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|