C11H15FO3P- — CID 100943518
(5E)-5-[diethoxyphosphoryl(fluoro)methylidene]cyclohexa-1,3-diene (PubChem CID 100943518) has the molecular formula C11H15FO3P- and a molecular weight of 245.21 g/mol. Its IUPAC name is (5E)-5-[diethoxyphosphoryl(fluoro)methylidene]cyclohexa-1,3-diene.
| Compound Name | (5E)-5-[diethoxyphosphoryl(fluoro)methylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 100943518 |
| Molecular Formula | C11H15FO3P- |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | (5E)-5-[diethoxyphosphoryl(fluoro)methylidene]cyclohexa-1,3-diene |
| SMILES | CCOP(=O)(OCC)/C(F)=C1/C=CC=C[CH-]1 |
| InChI | InChI=1S/C11H15FO3P/c1-3-14-16(13,15-4-2)11(12)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3/q-1 |
| InChIKey | VEUPIFUWCMAHGI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|