C13H20F3O3P — CID 10828883
[(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]cyclopropane (PubChem CID 10828883) has the molecular formula C13H20F3O3P and a molecular weight of 312.27 g/mol. Its IUPAC name is [(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]cyclopropane.
| Compound Name | [(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]cyclopropane |
|---|---|
| PubChem CID | 10828883 |
| Molecular Formula | C13H20F3O3P |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [(1E,3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-dienyl]cyclopropane |
| SMILES | CCOP(=O)(OCC)/C(C)=C(\C=C\C1CC1)C(F)(F)F |
| InChI | InChI=1S/C13H20F3O3P/c1-4-18-20(17,19-5-2)10(3)12(13(14,15)16)9-8-11-6-7-11/h8-9,11H,4-7H2,1-3H3/b9-8+,12-10+ |
| InChIKey | SJCQRNYVNJFQQP-CDKJVOIVSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|