C13H23O3P — CID 10611218
[(1Z)-2-diethoxyphosphoryl-4-methylpenta-1,3-dienyl]cyclopropane (PubChem CID 10611218) has the molecular formula C13H23O3P and a molecular weight of 258.30 g/mol. Its IUPAC name is [(1Z)-2-diethoxyphosphoryl-4-methylpenta-1,3-dienyl]cyclopropane.
| Compound Name | [(1Z)-2-diethoxyphosphoryl-4-methylpenta-1,3-dienyl]cyclopropane |
|---|---|
| PubChem CID | 10611218 |
| Molecular Formula | C13H23O3P |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [(1Z)-2-diethoxyphosphoryl-4-methylpenta-1,3-dienyl]cyclopropane |
| SMILES | CCOP(=O)(OCC)/C(C=C(C)C)=C\C1CC1 |
| InChI | InChI=1S/C13H23O3P/c1-5-15-17(14,16-6-2)13(9-11(3)4)10-12-7-8-12/h9-10,12H,5-8H2,1-4H3/b13-10- |
| InChIKey | VSDIIUOQZQOYHA-RAXLEYEMSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|