C12H23O3P — CID 134917811
(3E)-3-diethoxyphosphoryl-4,5-dimethylhexa-1,3-diene (PubChem CID 134917811) has the molecular formula C12H23O3P and a molecular weight of 246.29 g/mol. Its IUPAC name is (3E)-3-diethoxyphosphoryl-4,5-dimethylhexa-1,3-diene.
| Compound Name | (3E)-3-diethoxyphosphoryl-4,5-dimethylhexa-1,3-diene |
|---|---|
| PubChem CID | 134917811 |
| Molecular Formula | C12H23O3P |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3E)-3-diethoxyphosphoryl-4,5-dimethylhexa-1,3-diene |
| SMILES | C=C/C(=C(/C)C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H23O3P/c1-7-12(11(6)10(4)5)16(13,14-8-2)15-9-3/h7,10H,1,8-9H2,2-6H3/b12-11+ |
| InChIKey | QELAEMXQZQLOGT-VAWYXSNFSA-N |
| XLogP | 4.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|