C12H19O2P — CID 67134712
2-[ethoxy(methyl)phosphoryl]-1,5-dimethyl-6-methylidenecyclohexa-1,3-diene (PubChem CID 67134712) has the molecular formula C12H19O2P and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-[ethoxy(methyl)phosphoryl]-1,5-dimethyl-6-methylidenecyclohexa-1,3-diene.
| Compound Name | 2-[ethoxy(methyl)phosphoryl]-1,5-dimethyl-6-methylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67134712 |
| Molecular Formula | C12H19O2P |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[ethoxy(methyl)phosphoryl]-1,5-dimethyl-6-methylidenecyclohexa-1,3-diene |
| SMILES | C=C1C(C)=C(P(C)(=O)OCC)C=CC1C |
| InChI | InChI=1S/C12H19O2P/c1-6-14-15(5,13)12-8-7-9(2)10(3)11(12)4/h7-9H,3,6H2,1-2,4-5H3 |
| InChIKey | TUTMALOQTQCFRU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|