C10H19O3P — CID 11106827
3-diethoxyphosphoryl-4-methylpenta-1,3-diene (PubChem CID 11106827) has the molecular formula C10H19O3P and a molecular weight of 218.23 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-4-methylpenta-1,3-diene.
| Compound Name | 3-diethoxyphosphoryl-4-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 11106827 |
| Molecular Formula | C10H19O3P |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-diethoxyphosphoryl-4-methylpenta-1,3-diene |
| SMILES | C=CC(=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H19O3P/c1-6-10(9(4)5)14(11,12-7-2)13-8-3/h6H,1,7-8H2,2-5H3 |
| InChIKey | IQEBKZPFDXHVQV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|