C10H16F3O3P — CID 11254278
(3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-diene (PubChem CID 11254278) has the molecular formula C10H16F3O3P and a molecular weight of 272.20 g/mol. Its IUPAC name is (3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-diene.
| Compound Name | (3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-diene |
|---|---|
| PubChem CID | 11254278 |
| Molecular Formula | C10H16F3O3P |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (3E)-4-diethoxyphosphoryl-3-(trifluoromethyl)penta-1,3-diene |
| SMILES | C=C/C(=C(/C)P(=O)(OCC)OCC)C(F)(F)F |
| InChI | InChI=1S/C10H16F3O3P/c1-5-9(10(11,12)13)8(4)17(14,15-6-2)16-7-3/h5H,1,6-7H2,2-4H3/b9-8+ |
| InChIKey | SZEXNKRNFXRBDI-CMDGGOBGSA-N |
| XLogP | 4.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|