C12H21F2O3P — CID 102254198
1-diethoxyphosphoryl-4-ethyl-1,1-difluorohexa-2,3-diene (PubChem CID 102254198) has the molecular formula C12H21F2O3P and a molecular weight of 282.27 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-4-ethyl-1,1-difluorohexa-2,3-diene.
| Compound Name | 1-diethoxyphosphoryl-4-ethyl-1,1-difluorohexa-2,3-diene |
|---|---|
| PubChem CID | 102254198 |
| Molecular Formula | C12H21F2O3P |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-diethoxyphosphoryl-4-ethyl-1,1-difluorohexa-2,3-diene |
| SMILES | CCOP(=O)(OCC)C(F)(F)C=C=C(CC)CC |
| InChI | InChI=1S/C12H21F2O3P/c1-5-11(6-2)9-10-12(13,14)18(15,16-7-3)17-8-4/h10H,5-8H2,1-4H3 |
| InChIKey | GVCBXLXSCZONEU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|