C12H18F3O3P — CID 102260719
(2-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enylidene)cyclopentane (PubChem CID 102260719) has the molecular formula C12H18F3O3P and a molecular weight of 298.24 g/mol. Its IUPAC name is (2-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enylidene)cyclopentane.
| Compound Name | (2-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enylidene)cyclopentane |
|---|---|
| PubChem CID | 102260719 |
| Molecular Formula | C12H18F3O3P |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (2-diethoxyphosphoryl-3,3,3-trifluoroprop-1-enylidene)cyclopentane |
| SMILES | CCOP(=O)(OCC)C(=C=C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H18F3O3P/c1-3-17-19(16,18-4-2)11(12(13,14)15)9-10-7-5-6-8-10/h3-8H2,1-2H3 |
| InChIKey | PFLINDDUGDKTGO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|