C14H24F3O3P — CID 10404207
[3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-ylidene]cyclopentane (PubChem CID 10404207) has the molecular formula C14H24F3O3P and a molecular weight of 328.31 g/mol. Its IUPAC name is [3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-ylidene]cyclopentane.
| Compound Name | [3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-ylidene]cyclopentane |
|---|---|
| PubChem CID | 10404207 |
| Molecular Formula | C14H24F3O3P |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [3-di(propan-2-yloxy)phosphoryl-1,1,1-trifluoropropan-2-ylidene]cyclopentane |
| SMILES | CC(C)OP(=O)(CC(=C1CCCC1)C(F)(F)F)OC(C)C |
| InChI | InChI=1S/C14H24F3O3P/c1-10(2)19-21(18,20-11(3)4)9-13(14(15,16)17)12-7-5-6-8-12/h10-11H,5-9H2,1-4H3 |
| InChIKey | WQZBXFCIMICNQS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|