C12H22F3O3P — CID 10470157
(Z)-2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylhex-2-ene (PubChem CID 10470157) has the molecular formula C12H22F3O3P and a molecular weight of 302.27 g/mol. Its IUPAC name is (Z)-2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylhex-2-ene.
| Compound Name | (Z)-2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylhex-2-ene |
|---|---|
| PubChem CID | 10470157 |
| Molecular Formula | C12H22F3O3P |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (Z)-2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylhex-2-ene |
| SMILES | CCC/C(C)=C(\CP(=O)(OCC)OCC)C(F)(F)F |
| InChI | InChI=1S/C12H22F3O3P/c1-5-8-10(4)11(12(13,14)15)9-19(16,17-6-2)18-7-3/h5-9H2,1-4H3/b11-10+ |
| InChIKey | UWDVATIAHOYWTA-ZHACJKMWSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|