C10H18F3O3P — CID 10265338
2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylbut-2-ene (PubChem CID 10265338) has the molecular formula C10H18F3O3P and a molecular weight of 274.22 g/mol. Its IUPAC name is 2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylbut-2-ene.
| Compound Name | 2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylbut-2-ene |
|---|---|
| PubChem CID | 10265338 |
| Molecular Formula | C10H18F3O3P |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-(diethoxyphosphorylmethyl)-1,1,1-trifluoro-3-methylbut-2-ene |
| SMILES | CCOP(=O)(CC(=C(C)C)C(F)(F)F)OCC |
| InChI | InChI=1S/C10H18F3O3P/c1-5-15-17(14,16-6-2)7-9(8(3)4)10(11,12)13/h5-7H2,1-4H3 |
| InChIKey | MWQQAHPFMWMRNY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|