C8H17F2O3P — CID 151036446
2-diethoxyphosphoryl-1,1-difluoro-2-methylpropane (PubChem CID 151036446) has the molecular formula C8H17F2O3P and a molecular weight of 230.19 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-1,1-difluoro-2-methylpropane.
| Compound Name | 2-diethoxyphosphoryl-1,1-difluoro-2-methylpropane |
|---|---|
| PubChem CID | 151036446 |
| Molecular Formula | C8H17F2O3P |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-diethoxyphosphoryl-1,1-difluoro-2-methylpropane |
| SMILES | CCOP(=O)(OCC)C(C)(C)C(F)F |
| InChI | InChI=1S/C8H17F2O3P/c1-5-12-14(11,13-6-2)8(3,4)7(9)10/h7H,5-6H2,1-4H3 |
| InChIKey | MBDYONYTQDZFSP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|