C12H20F3O3P — CID 50993094
2-diethoxyphosphoryl-4-ethyl-1,1,1-trifluorohexa-2,3-diene (PubChem CID 50993094) has the molecular formula C12H20F3O3P and a molecular weight of 300.26 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-4-ethyl-1,1,1-trifluorohexa-2,3-diene.
| Compound Name | 2-diethoxyphosphoryl-4-ethyl-1,1,1-trifluorohexa-2,3-diene |
|---|---|
| PubChem CID | 50993094 |
| Molecular Formula | C12H20F3O3P |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-diethoxyphosphoryl-4-ethyl-1,1,1-trifluorohexa-2,3-diene |
| SMILES | CCOP(=O)(OCC)C(=C=C(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C12H20F3O3P/c1-5-10(6-2)9-11(12(13,14)15)19(16,17-7-3)18-8-4/h5-8H2,1-4H3 |
| InChIKey | QQQASLKSQWOURC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|